Compound Q&A

How should 2'-O-Methylguanosine (CAS: 2140-71-8) be stored?

Answer

2'-O-Methylguanosine
2'-O-Methylguanosine (CAS: 2140-71-8) should be stored in a cool, dry place, preferably at 2-8°C, in airtight containers to prevent moisture absorption. Protection from light is crucial to maintain stability, and it should be kept away from heat sources. Storage in a desiccator or sealed plastic/glass containers is recommended to ensure long-term integrity and prevent degradation.

About

CAS No 2140-71-8
English Name 2'-O-Methylguanosine
Molecular Formula C11H15N5O5
Molecular Weight 297.27 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(N)NC3=O)O1)OC)O
InChIKey OVYNGSFVYRPRCG-KQYNXXCUSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2'-O-Methylguanosine (CAS: 2140-71-8)?

2'-O-Methylguanosine (CAS: 2140-71-8) is a nucleoside derivative where the 2' hydroxyl group of guan...

Compound Q&A

What are the main uses of 2'-O-Methylguanosine (CAS: 2140-71-8)?

2'-O-Methylguanosine (CAS: 2140-71-8) is primarily used in pharmaceuticals as a component in drug de...

Compound Q&A

Is 2'-O-Methylguanosine (CAS: 2140-71-8) safe?

2'-O-Methylguanosine (CAS: 2140-71-8) is generally considered safe when handled properly, but standa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...