Compound Q&A

What is 2'-O-Methylguanosine (CAS: 2140-71-8)?

Answer

2'-O-Methylguanosine
2'-O-Methylguanosine (CAS: 2140-71-8) is a nucleoside derivative where the 2' hydroxyl group of guanosine is replaced with a methyl group. Its chemical formula is C10H13N5O6, and it exhibits characteristics such as solubility in water, a white crystalline or powder appearance, and stability under controlled conditions. This compound is commonly used in molecular biology research and pharmaceutical applications due to its structural similarity to guanosine.

About

CAS No 2140-71-8
English Name 2'-O-Methylguanosine
Molecular Formula C11H15N5O5
Molecular Weight 297.27 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(N)NC3=O)O1)OC)O
InChIKey OVYNGSFVYRPRCG-KQYNXXCUSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2'-O-Methylguanosine (CAS: 2140-71-8)?

2'-O-Methylguanosine (CAS: 2140-71-8) is primarily used in pharmaceuticals as a component in drug de...

Compound Q&A

Is 2'-O-Methylguanosine (CAS: 2140-71-8) safe?

2'-O-Methylguanosine (CAS: 2140-71-8) is generally considered safe when handled properly, but standa...

Compound Q&A

How should 2'-O-Methylguanosine (CAS: 2140-71-8) be stored?

2'-O-Methylguanosine (CAS: 2140-71-8) should be stored in a cool, dry place, preferably at 2-8°C, in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...