Compound Q&A

What is 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5)?

Answer

2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid
2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) is an organic compound with the molecular formula C14H10F9O4. It features a benzene ring substituted with two 2,2,2-trifluoroethoxy groups and a carboxylic acid functional group. This compound is known for its high reactivity due to fluorine atoms and is typically a white solid with low solubility in water. Its structure makes it valuable in chemical synthesis and specialized applications requiring fluorinated derivatives.

About

CAS No 35480-52-5
English Name 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid
Molecular Formula C11H8F6O4
Molecular Weight 318.17 g/mol
SMILES C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)OCC(F)(F)F
InChIKey YPGYLCZBZKRYQJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5)?

2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) is primarily used in pharmaceutical res...

Compound Q&A

Is 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) safe?

2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) requires careful handling due to potent...

Compound Q&A

How should 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) be stored?

Store 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid (CAS: 35480-52-5) in a cool, dry place with low hum...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...