Compound Q&A

What are the main uses of 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2)?

Answer

3-(3,4-Dimethoxyphenyl)propanoic acid
3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is primarily used as a key intermediate in the synthesis of pharmaceutical compounds, particularly those with anti-inflammatory and analgesic properties. It also finds applications in the development of agrochemicals and specialty chemicals. In research settings, it is used for the study of organic reactions and the design of new molecules. Its versatility makes it valuable in multiple industries, including drug discovery and chemical manufacturing.

About

CAS No 2107-70-2
English Name 3-(3,4-Dimethoxyphenyl)propanoic acid
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES COC1=C(C=C(C=C1)CCC(=O)O)OC
InChIKey LHHKQWQTBCTDQM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2)?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is an organic compound with the molecular for...

Compound Q&A

Is 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) safe?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is generally considered safe when handled pro...

Compound Q&A

How should 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) be stored?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) should be stored in a cool, dry, and dark pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...