Compound Q&A

What is 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2)?

Answer

3-(3,4-Dimethoxyphenyl)propanoic acid
3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is an organic compound with the molecular formula C13H16O5. It is a white to pale yellow solid with a characteristic aromatic odor. This compound is known for its acidic properties and is commonly used as an intermediate in organic synthesis. Its structure includes a carboxylic acid group attached to a propyl chain, which is further substituted with a 3,4-dimethoxyphenyl group, contributing to its reactivity and utility in various chemical applications.

About

CAS No 2107-70-2
English Name 3-(3,4-Dimethoxyphenyl)propanoic acid
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES COC1=C(C=C(C=C1)CCC(=O)O)OC
InChIKey LHHKQWQTBCTDQM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2)?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is primarily used as a key intermediate in th...

Compound Q&A

Is 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) safe?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) is generally considered safe when handled pro...

Compound Q&A

How should 3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) be stored?

3-(3,4-Dimethoxyphenyl)propanoic acid (CAS: 2107-70-2) should be stored in a cool, dry, and dark pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...