Compound Q&A

Is 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) safe?

Answer

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid
6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is generally considered safe when handled properly, but it requires caution due to its potential irritant properties. Safety protocols include wearing protective gloves, goggles, and lab coats, and ensuring adequate ventilation. Compliance with OSHA and EPA guidelines is recommended to minimize exposure risks during storage, use, or disposal.

About

CAS No 68441-17-8
English Name 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid
Molecular Formula C12H20O5
Molecular Weight 244.29 g/mol
SMILES CC(C(CCCCC=O)O)C(=O)CCC(=O)O
InChIKey AZUZXOSWBOBCJY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8)?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is a dicarboxylic acid with a hydroxy...

Compound Q&A

What are the main uses of 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8)?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is primarily used in pharmaceutical d...

Compound Q&A

How should 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) be stored?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) should be stored in a tightly sealed ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...