Compound Q&A

What is 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8)?

Answer

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid
6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is a dicarboxylic acid with a hydroxyl group at the 6th carbon and a methyl substituent at the 5th position. Its chemical formula is C11H22O4, and it exhibits structural features including ketone groups at positions 4 and 11. This compound is notable for its potential applications in organic synthesis and pharmaceutical research, though specific properties may require further experimental data.

About

CAS No 68441-17-8
English Name 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid
Molecular Formula C12H20O5
Molecular Weight 244.29 g/mol
SMILES CC(C(CCCCC=O)O)C(=O)CCC(=O)O
InChIKey AZUZXOSWBOBCJY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8)?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is primarily used in pharmaceutical d...

Compound Q&A

Is 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) safe?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) is generally considered safe when han...

Compound Q&A

How should 6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) be stored?

6-Hydroxy-5-methyl-4,11-dioxoundecanoic acid (CAS: 68441-17-8) should be stored in a tightly sealed ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...