Compound Q&A

What are the main uses of 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3)?

Answer

3-(1-Cyanoethyl)benzoic acid
3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) is primarily used in pharmaceutical research as a building block for drug development. It also serves in industrial applications, such as polymer synthesis and chemical intermediates. In research settings, it is valued for its utility in organic synthesis and functional group modification. Its unique structure makes it relevant in the production of specialized materials and agrochemicals.

About

CAS No 5537-71-3
English Name 3-(1-Cyanoethyl)benzoic acid
Molecular Formula C10H9NO2
Molecular Weight 175.18 g/mol
SMILES CC(C#N)C1=CC(=CC=C1)C(=O)O
InChIKey IRYIYPWRXROPSX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3)?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) is an organic compound with the chemical formula C9H8N...

Compound Q&A

Is 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) safe?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) requires careful handling due to potential irritant pr...

Compound Q&A

How should 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) be stored?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) should be stored in a cool, dry, and dark place, ideal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...