Compound Q&A

What is 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3)?

Answer

3-(1-Cyanoethyl)benzoic acid
3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) is an organic compound with the chemical formula C9H8NO2. It features a benzoic acid group attached to a 1-cyanoethyl substituent, making it a versatile intermediate in chemical synthesis. The compound is typically a white solid with moderate solubility in polar solvents and exhibits specific functional group reactivity due to its cyano and carboxylic acid moieties.

About

CAS No 5537-71-3
English Name 3-(1-Cyanoethyl)benzoic acid
Molecular Formula C10H9NO2
Molecular Weight 175.18 g/mol
SMILES CC(C#N)C1=CC(=CC=C1)C(=O)O
InChIKey IRYIYPWRXROPSX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3)?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) is primarily used in pharmaceutical research as a buil...

Compound Q&A

Is 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) safe?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) requires careful handling due to potential irritant pr...

Compound Q&A

How should 3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) be stored?

3-(1-Cyanoethyl)benzoic acid (CAS: 5537-71-3) should be stored in a cool, dry, and dark place, ideal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...