Compound Q&A

What are the main uses of (4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid (CAS: 24277-39-2)?

Answer

(4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid
This compound is primarily used in pharmaceutical research as a building block for drug development, particularly in the synthesis of chiral molecules. It also serves in organic chemistry as a functional group modifier and in academic studies for exploring stereochemical effects. Its unique structure makes it relevant for applications requiring precise stereocontrol, such as enzyme inhibitors or targeted therapies.

About

CAS No 24277-39-2
English Name (4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid
Molecular Formula C14H25NO6
Molecular Weight 303.36 g/mol
SMILES CC(C)(C)OC(=O)C(CCC(=O)O)NC(=O)OC(C)(C)C
InChIKey YMOYURYWGUWMFM-VIFPVBQESA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid (CAS: 24277-39-2)?

This compound is a chiral pentanoic acid derivative with the molecular formula C10H20O5N. It feature...

Compound Q&A

Is (4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid (CAS: 24277-39-2) safe?

Safety data for this compound is limited, but as a chemical intermediate, it requires standard lab p...

Compound Q&A

How should (4S)-5-[(2-Methyl-2-propanyl)oxy]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid (CAS: 24277-39-2) be stored?

Store in a sealed, airtight container in a cool, dry place, away from direct light and moisture. Mai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...