Compound Q&A

How should Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) be stored?

Answer

Amino(4-chlorophenyl)acetic acid
Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) should be stored in a cool, dry, and dark place at 25°C. Keep in a sealed, airtight container to prevent moisture absorption. Avoid exposure to light and heat to maintain stability. Store away from incompatible materials and ensure proper labeling for safe handling.

About

CAS No 6212-33-5
English Name Amino(4-chlorophenyl)acetic acid
Molecular Formula C8H8ClNO2
Molecular Weight 185.61 g/mol
SMILES C1=CC(=CC=C1C(C(=O)O)N)Cl
InChIKey QGJGBYXRJVIYGA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5)?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) is an organic compound with the chemical formula C...

Compound Q&A

What are the main uses of Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5)?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) is primarily used in pharmaceutical research as an...

Compound Q&A

Is Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) safe?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) requires careful handling due to potential skin an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...