Compound Q&A

What is Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5)?

Answer

Amino(4-chlorophenyl)acetic acid
Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) is an organic compound with the chemical formula C8H9ClNO2. It features an amino group attached to a 4-chlorophenyl ring on an acetic acid backbone. This compound is typically a white crystalline solid, known for its hygroscopic nature and solubility in polar solvents. It exhibits moderate reactivity due to the presence of the chlorine and amino functional groups.

About

CAS No 6212-33-5
English Name Amino(4-chlorophenyl)acetic acid
Molecular Formula C8H8ClNO2
Molecular Weight 185.61 g/mol
SMILES C1=CC(=CC=C1C(C(=O)O)N)Cl
InChIKey QGJGBYXRJVIYGA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5)?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) is primarily used in pharmaceutical research as an...

Compound Q&A

Is Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) safe?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) requires careful handling due to potential skin an...

Compound Q&A

How should Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) be stored?

Amino(4-chlorophenyl)acetic acid (CAS: 6212-33-5) should be stored in a cool, dry, and dark place at...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...