Compound Q&A

What are the main uses of 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
This compound is primarily used in pharmaceutical research as a key intermediate in the synthesis of various drugs. It also finds applications in polymer science for creating biodegradable materials and in organic chemistry as a building block for complex molecules. Its utility extends to industrial processes and chemical research due to its reactivity and structural adaptability.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Molecular Formula C11H17NO5
Molecular Weight 243.26 g/mol
SMILES CC(C)(C)OC(=O)N1C(CCC1=O)C(=O)OC
InChIKey FNTAOUUEQHKLIU-ZETCQYMHSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8)?

2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) is a syn...

Compound Q&A

Is 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) safe?

As a chemical compound, 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CA...

Compound Q&A

How should 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) be stored?

To ensure stability and safety, this compound should be stored in a cool, dry, and dark place, ideal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...