Compound Q&A

What is 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) is a synthetic organic compound characterized by its pyrrolidinedicarboxylate structure with specific substituents. It is a white to pale yellow solid with moderate solubility in organic solvents. The compound is known for its stability under normal conditions and is commonly used in chemical synthesis due to its functional group versatility.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Molecular Formula C11H17NO5
Molecular Weight 243.26 g/mol
SMILES CC(C)(C)OC(=O)N1C(CCC1=O)C(=O)OC
InChIKey FNTAOUUEQHKLIU-ZETCQYMHSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8)?

This compound is primarily used in pharmaceutical research as a key intermediate in the synthesis of...

Compound Q&A

Is 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) safe?

As a chemical compound, 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CA...

Compound Q&A

How should 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 108963-96-8) be stored?

To ensure stability and safety, this compound should be stored in a cool, dry, and dark place, ideal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...