Compound Q&A

What are the main uses of 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7)?

Answer

4-Hydroxy-1-naphthalenesulfonic acid
4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is primarily used in the production of azo dyes, such as tartrazine and sunset yellow, which are widely applied in the food and textile industries. It also serves as an important intermediate in pharmaceutical synthesis, contributing to the development of drugs and other chemical products. Additionally, it finds applications in research and industrial chemical processes due to its reactivity and structural versatility.

About

CAS No 84-87-7
English Name 4-Hydroxy-1-naphthalenesulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.23699999999997 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)O
InChIKey HGWQOFDAUWCQDA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7)?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is an organic compound with the chemical formula...

Compound Q&A

Is 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) safe?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is generally considered safe when handled proper...

Compound Q&A

How should 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) be stored?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) should be stored in a cool, dry, and well-ventil...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...