Compound Q&A

What is 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7)?

Answer

4-Hydroxy-1-naphthalenesulfonic acid
4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is an organic compound with the chemical formula C10H8O3S. It is a white crystalline solid that is soluble in water and commonly used as a precursor in the synthesis of various dyes and pharmaceutical intermediates. The compound contains a naphthalene ring with a sulfonic acid group and a hydroxyl group, providing it with unique chemical reactivity and functional properties.

About

CAS No 84-87-7
English Name 4-Hydroxy-1-naphthalenesulfonic acid
Molecular Formula C10H8O4S
Molecular Weight 224.24 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)O
InChIKey HGWQOFDAUWCQDA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7)?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is primarily used in the production of azo dyes,...

Compound Q&A

Is 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) safe?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) is generally considered safe when handled proper...

Compound Q&A

How should 4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) be stored?

4-Hydroxy-1-naphthalenesulfonic acid (CAS: 84-87-7) should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...