Compound Q&A

What is Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8)?

Answer

Diphenyl(4-piperidinyl)methanol
Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) is an organic compound with the chemical formula C16H19NO. It features a methanol group attached to a piperidine ring, which is linked to two phenyl groups. This compound is known for its chiral structure and is commonly used in pharmaceutical and research applications. It is typically a white solid with moderate solubility in organic solvents and exhibits specific chemical reactivity due to its functional groups.

About

CAS No 115-46-8
English Name Diphenyl(4-piperidinyl)methanol
Molecular Formula C18H21NO
Molecular Weight 267.37 g/mol
SMILES C1CNCCC1C(C2=CC=CC=C2)(C3=CC=CC=C3)O
InChIKey ZMISODWVFHHWNR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8)?

Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) is primarily used as a synthetic intermediate in pha...

Compound Q&A

Is Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) safe?

Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) requires careful handling due to potential toxicity....

Compound Q&A

How should Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) be stored?

Diphenyl(4-piperidinyl)methanol (CAS: 115-46-8) should be stored in a cool, dry, and dark place, ide...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...