Compound Q&A

What are the main uses of 1,6-Naphthalenediol (CAS: 575-44-0)?

Answer

1,6-Naphthalenediol
1,6-Naphthalenediol finds applications in pharmaceutical research, where it serves as a precursor for various bioactive compounds. It is also used in the synthesis of dyes, pigments, and other organic materials. Additionally, it plays a role in the development of specialty chemicals and can be utilized in the creation of functional materials for advanced technologies.

About

CAS No 575-44-0
English Name 1,6-Naphthalenediol
Molecular Formula C10H8O2
Molecular Weight 160.17 g/mol
SMILES C1=CC2=C(C=CC(=C2)O)C(=C1)O
InChIKey FZZQNEVOYIYFPF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 1,6-Naphthalenediol (CAS: 575-44-0)?

1,6-Naphthalenediol is an organic compound with the chemical formula C10H8O2. It is a dihydroxy deri...

Compound Q&A

Is 1,6-Naphthalenediol (CAS: 575-44-0) safe?

1,6-Naphthalenediol is generally considered safe when handled properly, but it can be harmful if ing...

Compound Q&A

How should 1,6-Naphthalenediol (CAS: 575-44-0) be stored?

1,6-Naphthalenediol should be stored in a cool, dry, and well-ventilated area, away from light and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...