Compound Q&A

What is 1,6-Naphthalenediol (CAS: 575-44-0)?

Answer

1,6-Naphthalenediol
1,6-Naphthalenediol is an organic compound with the chemical formula C10H8O2. It is a dihydroxy derivative of naphthalene, characterized by two hydroxyl groups attached to the 1 and 6 positions of the aromatic ring. This compound is known for its strong hydrogen bonding capabilities and is often used in chemical synthesis due to its reactivity and structural properties.

About

CAS No 575-44-0
English Name 1,6-Naphthalenediol
Molecular Formula C10H8O2
Molecular Weight 160.17 g/mol
SMILES C1=CC2=C(C=CC(=C2)O)C(=C1)O
InChIKey FZZQNEVOYIYFPF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 1,6-Naphthalenediol (CAS: 575-44-0)?

1,6-Naphthalenediol finds applications in pharmaceutical research, where it serves as a precursor fo...

Compound Q&A

Is 1,6-Naphthalenediol (CAS: 575-44-0) safe?

1,6-Naphthalenediol is generally considered safe when handled properly, but it can be harmful if ing...

Compound Q&A

How should 1,6-Naphthalenediol (CAS: 575-44-0) be stored?

1,6-Naphthalenediol should be stored in a cool, dry, and well-ventilated area, away from light and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...