Compound Q&A

Is 5'-Guanylic acid (disodium salt) (CAS: 5550-12-9) safe?

Answer

5'-Guanylic acid (disodium salt)
5'-Guanylic acid (disodium salt) is generally recognized as safe (GRAS) for food use by regulatory agencies like the FDA. However, prolonged exposure to high concentrations may cause mild irritation. Safety standards emphasize proper handling, such as avoiding inhalation and skin contact, and using protective gear. Its CAS number is 5550-12-9, and it adheres to industrial safety guidelines when used appropriately.

About

CAS No 5550-12-9
English Name 5'-Guanylic acid (disodium salt)
Molecular Formula C10H12N5Na2O8P
Molecular Weight 407.19 g/mol
SMILES O=P(OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(N)NC3=O)O1)O)O)(O[Na])O[Na]
InChIKey PVBRXXAAPNGWGE-LGVAUZIVSA-L
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 5'-Guanylic acid (disodium salt) (CAS: 5550-12-9)?

5'-Guanylic acid (disodium salt) is a nucleotide derivative with the chemical formula C10H12N5O7PNa2...

Compound Q&A

What are the main uses of 5'-Guanylic acid (disodium salt) (CAS: 5550-12-9)?

5'-Guanylic acid (disodium salt) is primarily used in the food industry as a flavor enhancer, partic...

Compound Q&A

How should 5'-Guanylic acid (disodium salt) (CAS: 5550-12-9) be stored?

5'-Guanylic acid (disodium salt) should be stored in a cool, dry place (below 25°C), away from light...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...