Compound Q&A

How should 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) be stored?

Answer

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose
1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) should be stored in a cool, dry place away from light. It is typically kept in a sealed container at a temperature range of 2-8°C to maintain stability. Avoid exposure to moisture and air to prevent degradation, and ensure storage conditions are suitable for its chemical properties and shelf life.

About

CAS No 62211-93-2
English Name 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose
Molecular Formula C11H16O7
Molecular Weight 260.24 g/mol
SMILES C[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)O1
InChIKey NXEJETQVUQAKTO-PRTGYXNQSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2)?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is a modified sugar derivative deri...

Compound Q&A

What are the main uses of 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2)?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is primarily used in pharmaceutical...

Compound Q&A

Is 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) safe?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is generally considered safe when h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...