Compound Q&A

What is 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2)?

Answer

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose
1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is a modified sugar derivative derived from ribose. Its chemical formula is C10H14O7, and it is characterized by the acetylation of three hydroxyl groups on the sugar ring. This compound is commonly used in chemical synthesis and research due to its structural versatility and reactivity.

About

CAS No 62211-93-2
English Name 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose
Molecular Formula C11H16O7
Molecular Weight 260.24 g/mol
SMILES C[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)O1
InChIKey NXEJETQVUQAKTO-PRTGYXNQSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2)?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is primarily used in pharmaceutical...

Compound Q&A

Is 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) safe?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) is generally considered safe when h...

Compound Q&A

How should 1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) be stored?

1,2,3-Tri-O-acetyl-5-deoxy-beta-D-ribofuranose (CAS: 62211-93-2) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...