Compound Q&A

How should Amoxicillin (CAS: 26787-78-0) be stored?

Answer

Amoxicillin
Amoxicillin should be stored in a cool, dry place away from moisture and direct sunlight. It is typically kept in a sealed container at a temperature between 15°C and 30°C. Avoid exposure to high humidity or extreme temperatures to maintain stability and potency. Always store it in a secure location to prevent accidental ingestion or contamination.

About

CAS No 26787-78-0
English Name Amoxicillin
Molecular Formula C16H19N3O5S
Molecular Weight 365.41 g/mol
SMILES CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(O)cc3)C(=O)N2[C@H]1C(=O)O
InChIKey LSQZJLSUYDQPKJ-NJBDSQKTSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Amoxicillin (CAS: 26787-78-0)?

Amoxicillin is an antibiotic medication, specifically a penicillin derivative, used to treat bacteri...

Compound Q&A

What are the main uses of Amoxicillin (CAS: 26787-78-0)?

Amoxicillin is primarily used in the pharmaceutical industry to treat bacterial infections such as p...

Compound Q&A

Is Amoxicillin (CAS: 26787-78-0) safe?

Amoxicillin is generally considered safe when used as directed. However, it may cause side effects s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...