Compound Q&A

What are the main uses of (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6)?

Answer

(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid
(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It has shown potential in medicinal chemistry for applications related to central nervous system disorders. Researchers also use it in studies involving receptor binding and molecular interactions due to its structural similarity to neurotransmitters.

About

CAS No 153-94-6
English Name (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid
Molecular Formula C11H12N2O2
Molecular Weight 204.23 g/mol
SMILES N[C@H](Cc1c[nH]c2ccccc12)C(=O)O
InChIKey QIVBCDIJIAJPQS-SECBINFHSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6)?

(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid, with CAS number 153-94-6, is a chiral organic compound...

Compound Q&A

Is (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6) safe?

(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6) is generally considered safe when handl...

Compound Q&A

How should (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6) be stored?

(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS: 153-94-6) should be stored in a cool, dry, and da...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...