Compound Q&A

What are the main uses of (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4)?

Answer

(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid
(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4) is widely utilized in pharmaceutical research for the development of drugs targeting neurological and metabolic disorders. It also plays a role in organic synthesis as a building block for more complex molecules. Additionally, it is used in the production of certain polymers and as a chiral auxiliary in asymmetric catalysis.

About

CAS No 51-35-4
English Name (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid
Molecular Formula C5H9NO3
Molecular Weight 131.13 g/mol
SMILES O[C@H]1CN[C@@H](C1)C(=O)O
InChIKey PMMYEEVYMWASQN-DMTCNVIQSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4)?

(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid, with CAS number 51-35-4, is a chiral organic compoun...

Compound Q&A

Is (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4) safe?

(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4) is generally considered safe when hand...

Compound Q&A

How should (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4) be stored?

(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 51-35-4) should be stored in a cool, dry, and w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...