Compound Q&A

What are the main uses of (6R,7R)-7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 79350-37-1)?

Answer

(6R,7R)-7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
This compound is primarily used in pharmaceutical research as a potential inhibitor of specific enzymes, particularly those involved in metabolic pathways. Its unique structure makes it a candidate for drug development targeting diseases such as cancer or infectious disorders. Additionally, it may find applications in chemical synthesis and as a research reagent for studying molecular interactions and biological mechanisms.

About

CAS No 79350-37-1
English Name (6R,7R)-7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C16H15N5O7S2
Molecular Weight 453.46 g/mol
SMILES C=CC1=C(N2C(C(C2=O)NC(=O)C(=NOCC(=O)O)C3=CSC(=N3)N)SC1)C(=O)O
InChIKey OKBVVJOGVLARMR-QMTHXVAHSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (6R,7R)-7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 79350-37-1)?

This compound, with the CAS number 79350-37-1, is a complex organic molecule containing a thiazole r...

Compound Q&A

Is (6R,7R)-7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 79350-37-1) safe?

Safety data for this compound is limited, but as with many complex organic chemicals, it should be h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...