Compound Q&A

What are the main uses of 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3)?

Answer

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) is primarily utilized in pharmaceutical research as a synthetic intermediate for drug development. It also serves in industrial applications, such as the production of dyes and polymers, and is studied in materials science for its potential in organic electronics. Its unique structure makes it valuable for chemical research and functional group modification studies.

About

CAS No 478-43-3
English Name 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
Molecular Formula C15H8O6
Molecular Weight 284.22 g/mol
SMILES OC(=O)c1cc(O)c2C(=O)c3c(O)cccc3C(=O)c2c1
InChIKey FCDLCPWAQCPTKC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3)?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) is a polycyclic ar...

Compound Q&A

Is 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) safe?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) requires careful h...

Compound Q&A

How should 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) be stored?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...