Compound Q&A

What is 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3)?

Answer

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) is a polycyclic aromatic compound with the chemical formula C14H10O4. It features hydroxyl groups at positions 4 and 5, a carboxylic acid group at position 2, and two ketone groups at positions 9 and 10. This compound is known for its stability in organic synthesis and is often used as a precursor in pharmaceutical and material science research.

About

CAS No 478-43-3
English Name 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid
Molecular Formula C15H8O6
Molecular Weight 284.22 g/mol
SMILES OC(=O)c1cc(O)c2C(=O)c3c(O)cccc3C(=O)c2c1
InChIKey FCDLCPWAQCPTKC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3)?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) is primarily utili...

Compound Q&A

Is 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) safe?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) requires careful h...

Compound Q&A

How should 4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) be stored?

4,5-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid (CAS: 478-43-3) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...