Compound Q&A

How should 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4) be stored?

Answer

4-(1H-Indol-3-yl)butanoic acid
4-(1H-Indol-3-yl)butanoic acid should be stored in a cool, dry, and well-ventilated place, away from light and moisture. It is typically kept in sealed containers to prevent degradation. Storage conditions should maintain a temperature range of 2-8°C, and it should be protected from strong oxidizing agents to ensure stability and prolong shelf life.

About

CAS No 133-32-4
English Name 4-(1H-Indol-3-yl)butanoic acid
Molecular Formula C12H13NO2
Molecular Weight 203.24 g/mol
SMILES OC(=O)CCCc1c[nH]c2c1cccc2
InChIKey JTEDVYBZBROSJT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4)?

4-(1H-Indol-3-yl)butanoic acid is a chemical compound with the CAS number 133-32-4. Its chemical for...

Compound Q&A

What are the main uses of 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4)?

4-(1H-Indol-3-yl)butanoic acid is primarily used in pharmaceutical research for the synthesis of var...

Compound Q&A

Is 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4) safe?

4-(1H-Indol-3-yl)butanoic acid is generally considered safe when handled properly, but it may have m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...