Compound Q&A

What are the main uses of 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4)?

Answer

4-(1H-Indol-3-yl)butanoic acid
4-(1H-Indol-3-yl)butanoic acid is primarily used in pharmaceutical research for the synthesis of various drugs, particularly those targeting neurological disorders. It also serves as an intermediate in the production of certain agrochemicals and is utilized in organic chemistry for the creation of complex molecules and functional groups.

About

CAS No 133-32-4
English Name 4-(1H-Indol-3-yl)butanoic acid
Molecular Formula C12H13NO2
Molecular Weight 203.241 g/mol
SMILES OC(=O)CCCc1c[nH]c2c1cccc2
InChIKey JTEDVYBZBROSJT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4)?

4-(1H-Indol-3-yl)butanoic acid is a chemical compound with the CAS number 133-32-4. Its chemical for...

Compound Q&A

Is 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4) safe?

4-(1H-Indol-3-yl)butanoic acid is generally considered safe when handled properly, but it may have m...

Compound Q&A

How should 4-(1H-Indol-3-yl)butanoic acid (CAS: 133-32-4) be stored?

4-(1H-Indol-3-yl)butanoic acid should be stored in a cool, dry, and well-ventilated place, away from...

Compound Q&A

What industries use (1R,3S)-1,3-Cyclopentanediol (CAS: 16326-97-9)?

(1R,3S)-1,3-Cyclopentanediol finds applications in various industries. In the ph...

16326-97-9(1R,3S)-1,3-Cyclopen...
Compound Q&A

What precautions should be taken when handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine (CAS: 637-31-0)?

When handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine, it i...

637-31-0N'-[4-(Dimethylamino...
Compound Q&A

Are there alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine (CAS: 1352318-16-1) in synthesis?

There are several alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine in ...

1352318-16-15-(2,4-Difluoropheny...
Compound Q&A

What regulatory guidelines apply to 1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6)?

1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6) must comply with the Globally...

382141-68-61-(3-Methoxyphenoxy)...