Compound Q&A

What is 3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8)?

Answer

3-O-Ethyl-L-Ascorbic Acid
3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) is a derivative of ascorbic acid, commonly used as a stable antioxidant. It has the chemical formula C8H12O6 and appears as a white crystalline powder. This compound exhibits strong reducing properties and is soluble in water and ethanol. Its ethyl ester structure enhances solubility and shelf life compared to standard ascorbic acid, making it valuable in various applications. It is often used in formulations requiring prolonged stability and antioxidant activity.

About

CAS No 86404-04-8
English Name 3-O-Ethyl-L-Ascorbic Acid
Molecular Formula C8H12O6
Molecular Weight 204.17799999999997 g/mol
SMILES O[C@@H](CO)[C@@H](O1)C(OCC)=C(O)C1=O
InChIKey ZGSCRDSBTNQPMS-UJURSFKZSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8)?

3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) is widely used in pharmaceuticals as a vitamin C derivat...

Compound Q&A

Is 3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) safe?

3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) is generally considered safe when used as directed. It h...

Compound Q&A

How should 3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) be stored?

3-O-Ethyl-L-Ascorbic Acid (CAS: 86404-04-8) should be stored in a cool, dry place, away from light a...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...