Compound Q&A

Is (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0) safe?

Answer

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, is generally considered safe when handled properly. However, it may cause skin and eye irritation. Safety standards recommend using personal protective equipment (PPE) such as gloves and goggles. Proper ventilation and adherence to standard chemical handling protocols are essential to ensure safe usage.

About

CAS No 138-59-0
English Name (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
Molecular Formula C7H10O5
Molecular Weight 174.15 g/mol
SMILES O[C@H]1[C@H](O)[C@H](O)C=C(C(O)=O)C1
InChIKey JXOHGGNKMLTUBP-HSUXUTPPSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0)?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, with CAS number 138-59-0, is a cyclic o...

Compound Q&A

What are the main uses of (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0)?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, is primarily used in phar...

Compound Q&A

How should (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0) be stored?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...