Compound Q&A

What are the main uses of (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0)?

Answer

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, is primarily used in pharmaceutical research for the development of drugs targeting metabolic disorders. It also serves as a building block in the synthesis of natural products and organic compounds. Its unique structure makes it valuable in biochemical studies and for creating derivatives with specific functional properties.

About

CAS No 138-59-0
English Name (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
Molecular Formula C7H10O5
Molecular Weight 174.15 g/mol
SMILES O[C@H]1[C@H](O)[C@H](O)C=C(C(O)=O)C1
InChIKey JXOHGGNKMLTUBP-HSUXUTPPSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0)?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, with CAS number 138-59-0, is a cyclic o...

Compound Q&A

Is (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0) safe?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, is generally considered s...

Compound Q&A

How should (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid (CAS: 138-59-0) be stored?

(3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid, CAS 138-59-0, should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...