Compound Q&A

What are the main uses of (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0)?

Answer

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol
(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is primarily used in pharmaceutical research for its potential therapeutic applications. It serves as a synthetic intermediate and is studied for its role in hormone synthesis. This compound is also used in organic chemistry for structural analysis and in biochemistry to understand lipid metabolism. Its unique stereochemistry makes it valuable in drug development and molecular studies.

About

CAS No 67-97-0
English Name (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol
Molecular Formula C27H44O
Molecular Weight 384.65 g/mol
SMILES C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C
InChIKey QYSXJUFSXHHAJI-YRZJJWOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0)?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is a steroidal compound with a complex...

Compound Q&A

Is (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) safe?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is generally considered safe when hand...

Compound Q&A

How should (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) be stored?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...