Compound Q&A

What is (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0)?

Answer

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol
(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is a steroidal compound with a complex structure. It is a derivative of cholesterol, lacking the 9,10 bond. This compound exhibits specific stereochemistry and is known for its biological activity. It is commonly used in research for its potential pharmacological effects. Its molecular formula is C27H46O2, and it is typically a solid at room temperature with moderate solubility in organic solvents.

About

CAS No 67-97-0
English Name (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol
Molecular Formula C27H44O
Molecular Weight 384.65 g/mol
SMILES C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C
InChIKey QYSXJUFSXHHAJI-YRZJJWOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0)?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is primarily used in pharmaceutical re...

Compound Q&A

Is (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) safe?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) is generally considered safe when hand...

Compound Q&A

How should (3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) be stored?

(3S,5Z,7E)-9,10-Secocholesta-5,7,10-trien-3-ol (CAS: 67-97-0) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...