Compound Q&A

What are the main uses of (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5)?

Answer

(2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol
(2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) is primarily used in pharmaceutical research for developing antiviral and antibiotic drugs. Its structure allows modification into various bioactive molecules. It also serves as an industrial chemical in synthetic pathways and is studied in research for its potential in targeting specific enzymes or receptors. Applications span drug discovery, chemical synthesis, and medicinal research.

About

CAS No 38304-91-5
English Name (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol
Molecular Formula C9H15N5O
Molecular Weight 209.25 g/mol
SMILES Nc1cc(nc(N)[n+]1[O-])N2CCCCC2
InChIKey ZIMGGGWCDYVHOY-PKNBQFBNSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5)?

(2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) is a pyrimidine derivativ...

Compound Q&A

Is (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) safe?

Safety data for (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) is limite...

Compound Q&A

How should (2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) be stored?

(2E)-6-Amino-2-imino-4-(1-piperidinyl)-1(2H)-pyrimidinol (CAS: 38304-91-5) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...