Compound Q&A

What are the main uses of trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8)?

Answer

trans-4-(Aminomethyl)cyclohexanecarboxylic acid
Trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8) is primarily used in the pharmaceutical industry as a building block for the synthesis of various drugs, including antifibrinolytic agents. It is also employed in research for developing new compounds and in industrial applications for chemical manufacturing. Its unique chemical structure allows it to participate in multiple reaction pathways, making it versatile for medicinal and organic chemistry purposes.

About

CAS No 1197-18-8
English Name trans-4-(Aminomethyl)cyclohexanecarboxylic acid
Molecular Formula C8H15NO2
Molecular Weight 157.21 g/mol
SMILES NC[C@H]1CC[C@@H](CC1)C(=O)O
InChIKey GYDJEQRTZSCIOI-LJGSYFOKSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8)?

Trans-4-(Aminomethyl)cyclohexanecarboxylic acid, also known by its CAS number 1197-18-8, is an organ...

Compound Q&A

Is trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8) safe?

Trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8) is generally considered safe when h...

Compound Q&A

How should trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8) be stored?

Trans-4-(Aminomethyl)cyclohexanecarboxylic acid (CAS: 1197-18-8) should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...