Compound Q&A

How should N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (CAS: 73-31-4) be stored?

Answer

N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide
N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (melatonin, CAS: 73-31-4) should be stored in a cool, dry place away from light. It is stable at room temperature but may degrade if exposed to high heat or moisture. To maintain its potency, it should be kept in a sealed container. Proper storage is crucial for preserving its chemical integrity and effectiveness in various applications.

About

CAS No 73-31-4
English Name N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide
Molecular Formula C13H16N2O2
Molecular Weight 232.28299999999996 g/mol
SMILES COc1ccc2[nH]cc(CCNC(=O)C)c2c1
InChIKey DRLFMBDRBRZALE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (CAS: 73-31-4)?

N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide, also known as melatonin (CAS: 73-31-4), is a naturall...

Compound Q&A

What are the main uses of N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (CAS: 73-31-4)?

N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (melatonin, CAS: 73-31-4) is primarily used in pharmac...

Compound Q&A

Is N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (CAS: 73-31-4) safe?

N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]acetamide (melatonin, CAS: 73-31-4) is generally considered safe...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...