AD

N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride (1:1)(CAS: 1189953-78-3)

N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride (1:1)
CAS Number

Related Products

Other Suppliers for N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride (1:1)

Basic Information

Molecular Formula
C22H18D6ClN3O4
Molecular Weight
389.48 g/mol

Chemical Identifiers

SMILES
[2H]C([2H])([2H])OCCOc1cc2c(cc1OCCOC([2H])([2H])[2H])ncnc2Nc3cccc(c3)C#C.Cl
InChIKey
GTTBEUCJPZQMDZ-HVTBMTIBSA-N

Database References

FAQ

N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride is a chemical compound with the CAS number 1189953-78-3. It is a quinazolinamine derivative with unique structural properties, including the presence of a 3-ethynylphenyl group, methoxyethoxy substituents, and a quinazolinamine ring. This compound is characterized by its chemical stability and specific functional groups, which make it suitable for various applications.
N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride is primarily used in pharmaceutical research and development. It serves as a potential lead compound for drug discovery, especially in the areas of anti-inflammatory and analgesic therapies. Additionally, it may find applications in synthetic chemistry and as a reagent in organic synthesis.
N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride is generally considered safe when handled properly. However, like many chemical compounds, it requires appropriate safety measures such as the use of gloves, goggles, and a fume hood to prevent skin contact, inhalation, and accidental ingestion. Storage should be in a secure, labeled container away from heat and direct sunlight.
N-(3-Ethynylphenyl)-6,7-bis{2-[(~2~H_3_)methyloxy]ethoxy}-4-quinazolinamine hydrochloride should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep the compound in a tightly sealed, amber-colored glass container to protect it from light and potential degradation. Proper storage conditions are essential to maintain the chemical's stability and effectiveness.

Safety Notice

Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.

Always follow proper handling procedures

Contact Information

Email

lgan@artis-chem.com