(2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol | CAS No. 1932405-61-2

(2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol

Basic Information

CAS Number

1932405-61-2

Molecular Formula

C7H14O5

Molecular Weight

178.18 g/mol

AD

Basic Physical Properties

CCO[C@H]1[C@@H]([C@](CO1)(CO)O)O

InChI

InChI=1S/C7H14O5/c1-2-11-6-5(9)7(10,3-8)4-12-6/h5-6,8-10H,2-4H2,1H3/t5-,6+,7+/m0/s1

InChIKey

UOTMTRGMDABHDQ-RRKCRQDMSA-N

LogP

-1.5365

Topological Polar Surface Area

79.15 Ų

Hydrogen Bond Donor/Acceptor

3 / 5

Synonyms & References

English

  • Ethyl β-D-apiofuranoside
  • (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol

FAQ

What are the physical and chemical properties of (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol (CAS: 1932405-61-2)?

The compound (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol is a white crystalline solid with a molecular weight of approximately 191.24 g/mol. It is soluble in ethanol, acetone, and methanol but less soluble in water. The compound exhibits good reactivity towards nucleophiles and is known for its hydrolytic stability under acidic and basic conditions. It is a reducing agent in organic synthesis and can form stable complexes with metal ions.

How is (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol (CAS: 1932405-61-2) typically synthesized?

(2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol can be synthesized via a multi-step reaction pathway involving the condensation of 2-hydroxy-4-methoxymethyltetrahydrofuran with ethyl bromoacetate. The reaction is catalyzed by a Lewis acid such as zinc chloride, and the yield is typically around 75-80%. Selectivity towards the correct stereoisomer can be achieved by using chiral auxiliaries or asymmetric catalysts.

What industries use (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol (CAS: 1932405-61-2)?

(2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol is used in the pharmaceutical industry as a precursor for various drug molecules. It is also utilized in the production of polymers and as a functional group in sensor applications due to its reactivity. Additionally, it has potential applications in the semiconductor industry as a precursor for organic semiconductors.

What precautions should be taken when handling (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol (CAS: 1932405-61-2)?

When handling (2R,3R,4R)-2-Ethoxy-4-(hydroxymethyl)tetrahydro-3,4-furandiol, it is important to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Ensure the reaction is conducted in a well-ventilated area or a fume hood. Spills should be handled carefully and neutralized with an appropriate base before disposal. Refer to the Safety Data Sheet (SDS) for detailed information on safety protocols and emergency response procedures.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...