Compound Q&A

What is (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 1250-97-1)?

Answer

(11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate
(11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate is a synthetic steroid compound. It is a derivative of progesterone and has a chemical structure with specific functional groups that contribute to its biological activity. This compound is characterized by its dihydroxy and dioxo functionalities, which play a crucial role in its biological effects. It is often used in pharmaceutical research and development due to its hormonal properties.

About

CAS No 1250-97-1
English Name (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate
Molecular Formula C23H32O6
Molecular Weight 404.5 g/mol
SMILES CC(=O)OCC(=O)C1(CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C)O
InChIKey ALEXXDVDDISNDU-VVCDUNCFSA-N
Last Updated: 2026-04-03 16:28

Related Q&A

Compound Q&A

What are the main uses of (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 1250-97-1)?

(11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate is primarily used in pharmaceutical res...

Compound Q&A

Is (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 1250-97-1) safe?

The safety of (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate depends on its intended u...

Compound Q&A

How should (11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 1250-97-1) be stored?

(11alpha)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl acetate should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...