Compound Q&A

What is Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate (CAS: 790658-58-1)?

Answer

Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate
Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate is an organic compound with the molecular formula C11H11F2NO2. It is a derivative of pyrrolidine and is primarily used in pharmaceuticals and synthetic chemistry for the preparation of various drug candidates. This compound is characterized by its unique structure, which includes a benzyl group and two fluorine atoms attached to the pyrrolidine ring.

About

English Name Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate
Molecular Formula C12H13F2NO2
Molecular Weight 241.23 g/mol
SMILES C1C(C(CN1C(=O)OCC2=CC=CC=C2)F)F
InChIKey NCRXQCGIQTUUJZ-GHMZBOCLSA-N
Last Updated: 2026-04-03 12:52

Related Q&A

Compound Q&A

What are the main uses of Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate (CAS: 790658-58-1)?

The main uses of Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate include its application in the...

Compound Q&A

Is Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate (CAS: 790658-58-1) safe?

Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate is generally safe when handled with appropriate...

Compound Q&A

How should Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate (CAS: 790658-58-1) be stored?

Benzyl (3R,4R)-3,4-difluoro-1-pyrrolidinecarboxylate should be stored in a cool, dry place, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...