Compound Q&A

Are there alternatives to 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2) in synthesis?

Answer

5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid
There are several alternatives to 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2) that can be used in synthesis depending on the desired properties and reactivity. Analogous compounds like 3-(1-piperidinylcarbonyl)anilines or structurally related pentanoic acids can serve as viable alternatives. Common alternative reagents include derivatives of piperidine or other cyclic amines, which can provide similar functional groups for chemical modifications.

About

English Name 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid
Molecular Formula C17H22N2O4
Molecular Weight 318.37 g/mol
SMILES C1CCN(CC1)C(=O)C2=CC(=CC=C2)NC(=O)CCCC(=O)O
InChIKey YPPGHBRXQABXEI-UHFFFAOYSA-N
Last Updated: 2026-04-03 08:30

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2)?

5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2) falls under various re...

Compound Q&A

What is the market or research trend for 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2)?

The market and research trends for 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1...

Compound Q&A

How should waste containing 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2) be handled?

Waste containing 5-Oxo-5-[3-(1-piperidinylcarbonyl)anilino]-pentanoic acid (CAS: 1030497-05-2) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...