Compound Q&A

Are there alternatives to 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride in synthesis (CAS: 1188263-74-2)?

Answer

2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (1:1)
Alternatives to 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 1188263-74-2) in synthesis may include similar compounds such as other aminomethylated pyrrolidine derivatives or related esters. Researchers often explore isomers or analogs for their specific chemical properties, potentially using reagents like different amines or carboxylic acids.

About

English Name 2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C10H21ClN2O2
Molecular Weight 236.74 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC1CN.Cl
InChIKey MQYQQPSDLQAGFQ-UHFFFAOYSA-N
Last Updated: 2026-04-03 08:30

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 1188263-74-2)?

2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 1188263-74-2) falls...

Compound Q&A

What is the market or research trend for 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 1188263-74-2)?

The market and research trends for 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydro...

Compound Q&A

How should waste containing 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 1188263-74-2) be handled?

Waste containing 2-Methyl-2-proanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride (CAS: 118...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...