Compound Q&A

Are there alternatives to Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) in synthesis?

Answer

Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl-
There are several alternatives to Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) in synthesis, including other organosilanes such as trimethylsilane and triethylsilane. These alternatives offer similar functional groups but may have different reactivity and stability. In specific cases, other reagents like organolithium compounds or Grignard reagents can be used as substitutes. It is recommended to evaluate the specific reaction conditions and properties of the target compound to choose the most appropriate alternative.

About

English Name Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl-
Molecular Formula C15H33BrOSi
Molecular Weight 337.4114 g/mol
SMILES CC(C)(C)[Si](C)(C)OCCCCCCCCCBr
InChIKey ZJJACWRNPJLOEF-UHFFFAOYSA-N
Last Updated: 2026-04-02 21:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1)?

Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) falls under the regulator...

Compound Q&A

What is the market or research trend for Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1)?

The market for Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) is growing...

Compound Q&A

How should waste containing Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) be handled?

Waste containing Silane, [(9-bromononyl)oxy](1,1-dimethylethyl)dimethyl- (CAS: 149051-24-1) should b...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...