Compound Q&A

What precautions should be taken when handling ONO 7643 FuMarate (CAS: 339539-92-3)?

Answer

ONO 7643 FuMarate
When handling ONO 7643 FuMarate, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name ONO 7643 FuMarate
Molecular Formula C35H46N6O7
Molecular Weight 662.78 g/mol
SMILES O=C(N1CCCC(C1)(Cc1ccccc1)C(=O)N(N(C)C)C)C(NC(=O)C(N)(C)C)Cc1c[nH]c2c1cccc2.OC(=O)C=CC(=O)O
InChIKey RJIOUAKEXOTTOG-UHFFFAOYSA-N
Last Updated: 2026-04-02 10:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of ONO 7643 FuMarate (CAS: 339539-92-3)?

ONO 7643 FuMarate is a crystalline compound with a molecular weight of approximately 368.4 g/mol. It...

Compound Q&A

How is ONO 7643 FuMarate (CAS: 339539-92-3) typically synthesized?

ONO 7643 FuMarate is synthesized through a multi-step process involving the carboxylation of fumaric...

Compound Q&A

What industries use ONO 7643 FuMarate (CAS: 339539-92-3)?

ONO 7643 FuMarate is primarily used in the pharmaceutical industry for the development of anti-infla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...