Compound Q&A

How is tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate (CAS: 148701-78-4) typically synthesized?

Answer

tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate
tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate is typically synthesized via an amide coupling reaction between tert-butyl piperidine-1-carboxylate and 2-phenylmaleimide. The process involves the use of a base like triethylamine and is often performed at room temperature. The overall yield is moderate to good, around 70-80%, depending on the reaction conditions.

About

English Name tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate
Molecular Formula C16H21NO3
Molecular Weight 275.34 g/mol
SMILES O=C1CCCN(C1c1ccccc1)C(=O)OC(C)(C)C
InChIKey GUERJXXMFLJFMZ-UHFFFAOYSA-N
Last Updated: 2026-04-02 05:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate (CAS: 148701-78-4)?

tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate (CAS: 148701-78-4)?

tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate (CAS: 148701-78-4)?

When handling tert-Butyl 3-oxo-2-phenylpiperidine-1-carboxylate, it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...