Compound Q&A

What are the physical and chemical properties of Somatostatin, pro- (CAS: 74315-46-1)?

Answer

Somatostatin, pro-
Somatostatin, pro- (CAS: 74315-46-1) is a peptide with a molecular weight of approximately 4920 Da. It is sparingly soluble in water. The compound is known for its stability under acidic and neutral conditions but is reactive towards strong bases. It crystallizes in a hexagonal form with a specific melting point range.

About

CAS No 74315-46-1
English Name Somatostatin, pro-
Molecular Formula C137H207N41O39S3
Molecular Weight 3148.56 g/mol
SMILES S(C)CCC(C(NC(C)C(N1CCCC1C(NC(C(NC(C(NC(C(NC(C(NC(C(NCC(NC1CSSCC(C(=O)O)NC(C(CO)NC(C(C(C)O)NC(C(CC2C=CC=CC=2)NC(C(C(C)O)NC(C(CCCCN)NC(C(CC2=CNC3C=CC=CC2=3)NC(C(CC2C=CC=CC=2)NC(C(CC2C=CC=CC=2)NC(C(CC(N)=O)NC(C(CCCCN)NC1=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)C)=O)CCCCN)=O)CCCNC(=N)N)=O)CCC(=O)O)=O)CCCNC(=N)N)=O)=O)=O)NC(C(C)NC(C1CCCN1C(C(CC(N)=O)NC(C(CO)NC(C(CC(N)=O)NC(C(C)NC(C(CO)N)=O)=O)=O)=O)=O)=O)=O
InChIKey GGYTXJNZMFRSLX-UHFFFAOYSA-N
Last Updated: 2026-04-02 00:18

Related Q&A

Compound Q&A

How is Somatostatin, pro- (CAS: 74315-46-1) typically synthesized?

Somatostatin, pro- (CAS: 74315-46-1) is synthesized through solid-phase peptide synthesis using FMOC...

Compound Q&A

What industries use Somatostatin, pro- (CAS: 74315-46-1)?

Somatostatin, pro- (CAS: 74315-46-1) is primarily used in the pharmaceutical industry for its role a...

Compound Q&A

What precautions should be taken when handling Somatostatin, pro- (CAS: 74315-46-1)?

When handling Somatostatin, pro- (CAS: 74315-46-1), appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...