Compound Q&A

What industries use (+/-)-Lisofylline-d6 (CAS: 1185995-26-9)?

Answer

(+/-)-Lisofylline-d6
The pharmaceutical industry uses (+/-)-Lisofylline-d6 (CAS: 1185995-26-9) for its potential as a bronchodilator and anti-inflammatory agent. It may also be used in the research and development of new drugs for respiratory diseases.

About

English Name (+/-)-Lisofylline-d6
Molecular Formula C13H14D6N4O3
Molecular Weight 286.36 g/mol
SMILES CC(CCCCn1c(=O)c2c(n(c1=O)C([2H])([2H])[2H])ncn2C([2H])([2H])[2H])O
InChIKey NSMXQKNUPPXBRG-XERRXZQWSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+/-)-Lisofylline-d6 (CAS: 1185995-26-9)?

The physical and chemical properties of (+/-)-Lisofylline-d6 (CAS: 1185995-26-9) include a white cry...

Compound Q&A

How is (+/-)-Lisofylline-d6 (CAS: 1185995-26-9) typically synthesized?

Typically, (+/-)-Lisofylline-d6 (CAS: 1185995-26-9) is synthesized through a series of amide couplin...

Compound Q&A

What precautions should be taken when handling (+/-)-Lisofylline-d6 (CAS: 1185995-26-9)?

When handling (+/-)-Lisofylline-d6 (CAS: 1185995-26-9), use personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...