Compound Q&A

What industries use (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol (CAS: 139264-69-0)?

Answer

(2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol
The compound (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol is primarily used in the pharmaceutical industry for its potential as a bioactive molecule. It may also find applications in the development of new sensors due to its functional groups, which could enhance its sensitivity and selectivity. Additionally, it could be relevant in the synthesis of certain polymers and semiconductors due to its aromatic and amine functionalities.

About

English Name (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol
Molecular Formula C15H23N3O
Molecular Weight 261.37 g/mol
SMILES CN(C)CCc1c[nH]c2c1cc(cc2)C[C@@H](CO)N
InChIKey XYSYRJCYRKMOFP-ZDUSSCGKSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol (CAS: 139264-69-0)?

The compound (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol is a crystalline s...

Compound Q&A

How is (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol (CAS: 139264-69-0) typically synthesized?

The compound (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol can be synthesized...

Compound Q&A

What precautions should be taken when handling (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol (CAS: 139264-69-0)?

When handling (2S)-2-Amino-3-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-1-propanol, it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...